ChemNet > CAS > 23136-39-2 2-Acetyl-5-nitrobenzo[b]furan
23136-39-2 2-Acetyl-5-nitrobenzo[b]furan
| product Name |
2-Acetyl-5-nitrobenzo[b]furan |
| CAS No |
23136-39-2 |
| Synonyms |
Methyl 5-nitrobenzo[b]furanyl ketone; 1-(5-nitro-1-benzofuran-2-yl)ethanone |
| Molecular Formula |
C10H7NO4 |
| Molecular Weight |
205.1669 |
| InChI |
InChI=1/C10H7NO4/c1-6(12)10-5-7-4-8(11(13)14)2-3-9(7)15-10/h2-5H,1H3 |
| Molecular Structure |
![23136-39-2 2-Acetyl-5-nitrobenzo[b]furan](https://images-a.chemnet.com/suppliers/chembase/cas9/cas23136-39-2.gif)
|
| Density |
1.37g/cm3 |
| Boiling point |
350.1°C at 760 mmHg |
| Refractive index |
1.625 |
| Flash point |
165.5°C |
| Vapour Pressur |
4.5E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
